1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-ethylurea structure
|
Common Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-ethylurea | ||
|---|---|---|---|---|
| CAS Number | 31652-49-0 | Molecular Weight | 226.23200 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-ethylurea |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.23200 |
| Exact Mass | 226.10700 |
| PSA | 88.62000 |
| Index of Refraction | 1.574 |
| InChIKey | FYLHKMGQCHPNSA-UHFFFAOYSA-N |
| SMILES | CCNC(=O)Nc1cc(=O)n(C)c(=O)n1C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |