1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-phenylthiourea
Modify Date: 2025-08-20 10:59:07
1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-phenylthiourea structure
|
Common Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 31652-21-8 | Molecular Weight | 290.34100 | |
| Density | 1.4g/cm3 | Boiling Point | 408.2ºC at 760mmHg | |
| Molecular Formula | C13H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.7ºC | |
| Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3-phenylthiourea |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 408.2ºC at 760mmHg |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.34100 |
| Flash Point | 200.7ºC |
| Exact Mass | 290.08400 |
| PSA | 107.19000 |
| LogP | 1.18640 |
| Index of Refraction | 1.69 |
| InChIKey | OMULIKWVUGOJBQ-UHFFFAOYSA-N |
| SMILES | Cn1c(NC(=S)Nc2ccccc2)cc(=O)n(C)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |