1H-Purine-2,6-dione,1,3-diethyl-3,7-dihydro-7-methyl- structure
|
Common Name | 1H-Purine-2,6-dione,1,3-diethyl-3,7-dihydro-7-methyl- | ||
|---|---|---|---|---|
| CAS Number | 31617-39-7 | Molecular Weight | 222.24400 | |
| Density | 1.34g/cm3 | Boiling Point | 427.3ºC at 760mmHg | |
| Molecular Formula | C10H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.2ºC | |
| Name | 1,3-diethyl-7-methylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 427.3ºC at 760mmHg |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.24400 |
| Flash Point | 212.2ºC |
| Exact Mass | 222.11200 |
| PSA | 61.82000 |
| Index of Refraction | 1.638 |
| InChIKey | WGMHUEQTUNLCNK-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)c2c(ncn2C)n(CC)c1=O |
| HS Code | 2933990090 |
|---|
|
~%
1H-Purine-2,6-d... CAS#:31617-39-7 |
| Literature: Kowalska; Maslankiewicz Polish Journal of Chemistry, 1997 , vol. 71, # 4 p. 454 - 459 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-diethyl-7-methyl-3,7-dihydro-purine-2,6-dione |
| 1,3-Diethylheteroxanthine |
| 1,3-Diethyl-7-methylxanthine |
| 1,3-diethyl-7-methyl-1H-purine-2,6(3H,7H)-dione |