2,3,4,5-Tetrabromo-1,5-diphenyl-1-pentanone
Modify Date: 2025-08-25 07:12:53
2,3,4,5-Tetrabromo-1,5-diphenyl-1-pentanone structure
|
Common Name | 2,3,4,5-Tetrabromo-1,5-diphenyl-1-pentanone | ||
|---|---|---|---|---|
| CAS Number | 31611-84-4 | Molecular Weight | 553.90800 | |
| Density | 1.938g/cm3 | Boiling Point | 526.4ºC at 760 mmHg | |
| Molecular Formula | C17H14Br4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.8ºC | |
| Name | 2,3,4,5-tetrabromo-1,5-diphenylpentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.938g/cm3 |
|---|---|
| Boiling Point | 526.4ºC at 760 mmHg |
| Molecular Formula | C17H14Br4O |
| Molecular Weight | 553.90800 |
| Flash Point | 113.8ºC |
| Exact Mass | 549.77800 |
| PSA | 17.07000 |
| LogP | 6.29600 |
| Index of Refraction | 1.659 |
| InChIKey | QADMPPHLZUFHDS-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Br)C(Br)C(Br)C(Br)c1ccccc1 |
| HS Code | 2914700090 |
|---|
|
~%
2,3,4,5-Tetrabr... CAS#:31611-84-4 |
| Literature: Giua Gazzetta Chimica Italiana, 1916 , vol. 46 I, p. 295 |
|
~%
2,3,4,5-Tetrabr... CAS#:31611-84-4 |
| Literature: Giua Gazzetta Chimica Italiana, 1916 , vol. 46 I, p. 295 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-Pentanone,2,3,4,5-tetrabromo-1,5-diphenyl |
| Cinnamalacetophenontetrabromid |
| 2,3,4,5-Tetrabrom-1,5-diphenyl-pentan-1-on |
| 2,3,4,5-tetrabromo-1,5-diphenyl-pentan-1-one |