2-ethoxy-5-nitropyridine structure
|
Common Name | 2-ethoxy-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 31594-45-3 | Molecular Weight | 168.150 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 272.3±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | 90-94 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 118.5±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Ethoxy-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.3±20.0 °C at 760 mmHg |
| Melting Point | 90-94 °C(lit.) |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 118.5±21.8 °C |
| Exact Mass | 168.053497 |
| PSA | 67.94000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | LYDVDLYMQVSLQD-UHFFFAOYSA-N |
| SMILES | CCOc1ccc([N+](=O)[O-])cn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-ethoxy-5-nitro-pyridine |
| 2-Ethoxy-5-nitropyridin |
| 2-(ethyloxy)-5-(nitro)pyridine |
| Pyridine, 2-ethoxy-5-nitro- |
| 2-Aethoxy-5-nitro-pyridin |
| MFCD01646181 |
| 2-ethoxy-5-nitropyridine |