1-(4-chlorophenyl)-3-phenylpyrrolidine-2,5-dione
Modify Date: 2025-09-23 18:04:06
1-(4-chlorophenyl)-3-phenylpyrrolidine-2,5-dione structure
|
Common Name | 1-(4-chlorophenyl)-3-phenylpyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 31591-72-7 | Molecular Weight | 285.72500 | |
| Density | 1.34g/cm3 | Boiling Point | 530.9ºC at 760 mmHg | |
| Molecular Formula | C16H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.9ºC | |
| Name | 1-(4-chlorophenyl)-3-phenylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 530.9ºC at 760 mmHg |
| Molecular Formula | C16H12ClNO2 |
| Molecular Weight | 285.72500 |
| Flash Point | 274.9ºC |
| Exact Mass | 285.05600 |
| PSA | 37.38000 |
| LogP | 3.45210 |
| Index of Refraction | 1.632 |
| InChIKey | NQDDHKGXBXCLFX-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccc2)C(=O)N1c1ccc(Cl)cc1 |
| HS Code | 2925190090 |
|---|
|
~%
1-(4-chlorophen... CAS#:31591-72-7 |
| Literature: Perisic-Janjic, Nada; Kaliszan, Roman; Wiczling, Pawel; Milosevic, Natasa; Uscumlic, Gordana; Banjac, Nebojsa Molecular Pharmaceutics, 2011 , vol. 8, # 2 p. 555 - 563 |
|
~33%
1-(4-chlorophen... CAS#:31591-72-7 |
| Literature: Banjac, Nebojsa; Trisovic, Nemanja; Vitnik, Zeljko; Vitnik, Vesna; Valentic, Natasa; Uscumlic, Gordana; Juranic, Ivan Monatshefte fur Chemie, 2013 , vol. 144, # 10 p. 1525 - 1535 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Succinimide,N-(p-chlorophenyl)-2-phenyl |
| 1-(4-chloro-phenyl)-3-phenyl-pyrrolidine-2,5-dione |
| N-(p-Chlorphenyl)-phenyl-3-succinimid |
| 1-(4-chlorophenyl)-3-phenyl-N-(p-chlorophenyl)-2-phenylsuccinimide |
| 1-(4-chlorophenyl)-3-phenylsuccinimide |
| N-(p-Chlorophenyl)-2-phenylsuccinimide |
| 2,5-Pyrrolidinedione,1-(4-chlorophenyl)-3-phenyl |