Carbonic acid,4-chlorophenyl (3,4-dimethoxyphenyl)methyl ester structure
|
Common Name | Carbonic acid,4-chlorophenyl (3,4-dimethoxyphenyl)methyl ester | ||
|---|---|---|---|---|
| CAS Number | 31558-52-8 | Molecular Weight | 322.74000 | |
| Density | 1.27g/cm3 | Boiling Point | 444ºC at 760mmHg | |
| Molecular Formula | C16H15ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | (4-chlorophenyl) (3,4-dimethoxyphenyl)methyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760mmHg |
| Molecular Formula | C16H15ClO5 |
| Molecular Weight | 322.74000 |
| Flash Point | 171.7ºC |
| Exact Mass | 322.06100 |
| PSA | 53.99000 |
| LogP | 4.07280 |
| Index of Refraction | 1.559 |
| InChIKey | OORGURYZZCLCDW-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)Oc2ccc(Cl)cc2)cc1OC |
|
~%
Carbonic acid,4... CAS#:31558-52-8 |
| Literature: Prokipcak,J.M.; Breckles,T.H. Canadian Journal of Chemistry, 1971 , vol. 49, p. 914 - 918 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3,4-Dimethoxybenzyl-p-chlorphenyl-carbonat |