Carbonic acid,(3,4-dimethoxyphenyl)methyl phenyl ester
Modify Date: 2025-10-02 11:40:39
Carbonic acid,(3,4-dimethoxyphenyl)methyl phenyl ester structure
|
Common Name | Carbonic acid,(3,4-dimethoxyphenyl)methyl phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 31558-51-7 | Molecular Weight | 288.29500 | |
| Density | 1.19g/cm3 | Boiling Point | 416.3ºC at 760mmHg | |
| Molecular Formula | C16H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184ºC | |
| Name | (3,4-dimethoxyphenyl)methyl phenyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 416.3ºC at 760mmHg |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29500 |
| Flash Point | 184ºC |
| Exact Mass | 288.10000 |
| PSA | 53.99000 |
| LogP | 3.41940 |
| Index of Refraction | 1.55 |
| InChIKey | IGKDWTFPNIYTHY-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)Oc2ccccc2)cc1OC |
|
~%
Carbonic acid,(... CAS#:31558-51-7 |
| Literature: Prokipcak,J.M.; Breckles,T.H. Canadian Journal of Chemistry, 1971 , vol. 49, p. 914 - 918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-dimethoxybenzyl phenyl carbonate |
| 3,4-Dimethoxybenzyl-phenyl-carbonat |