Benzaldehyde,4-nitro-, 2-(4-nitrophenyl)hydrazone structure
|
Common Name | Benzaldehyde,4-nitro-, 2-(4-nitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 3155-22-4 | Molecular Weight | 286.24300 | |
| Density | 1.39g/cm3 | Boiling Point | 488ºC at 760mmHg | |
| Molecular Formula | C13H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | 4-nitro-N-[(Z)-(4-nitrophenyl)methylideneamino]aniline |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 488ºC at 760mmHg |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.24300 |
| Flash Point | 248.9ºC |
| Exact Mass | 286.07000 |
| PSA | 116.03000 |
| LogP | 4.06840 |
| Index of Refraction | 1.649 |
| InChIKey | FGEMAQQCOLKPOK-ZROIWOOFSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2ccc([N+](=O)[O-])cc2)cc1 |
|
~97%
Benzaldehyde,4-... CAS#:3155-22-4 |
| Literature: Wang, Yingchun; Yi, Xianghui; Qin, Wen Asian Journal of Chemistry, 2012 , vol. 24, # 1 p. 217 - 219 |
|
~%
Benzaldehyde,4-... CAS#:3155-22-4 |
| Literature: Busch; Lang Journal fuer Praktische Chemie (Leipzig), 1936 , vol. <2> 144, p. 291,305 |