1,4-Pentanediamine,N4-(7-chloro-4-quinolinyl)-N1-methyl- structure
|
Common Name | 1,4-Pentanediamine,N4-(7-chloro-4-quinolinyl)-N1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 31510-53-9 | Molecular Weight | 277.79200 | |
| Density | 1.157g/cm3 | Boiling Point | 440.4ºC at 760mmHg | |
| Molecular Formula | C15H20ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 4-N-(7-chloroquinolin-4-yl)-1-N-methylpentane-1,4-diamine |
|---|
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 440.4ºC at 760mmHg |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.79200 |
| Flash Point | 220.1ºC |
| Exact Mass | 277.13500 |
| PSA | 36.95000 |
| LogP | 4.15210 |
| Index of Refraction | 1.612 |
| InChIKey | DVZMCGNRHJEGHP-UHFFFAOYSA-N |
| SMILES | CNCCCC(C)Nc1ccnc2cc(Cl)ccc12 |
|
~%
1,4-Pentanediam... CAS#:31510-53-9 |
| Literature: Journal of the American Chemical Society, , vol. 68, p. 1224 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |