a-D-Glucopyranose,2-[(2-carboxybenzoyl)amino]-2-deoxy- structure
|
Common Name | a-D-Glucopyranose,2-[(2-carboxybenzoyl)amino]-2-deoxy- | ||
|---|---|---|---|---|
| CAS Number | 31505-42-7 | Molecular Weight | 327.28700 | |
| Density | 1.63g/cm3 | Boiling Point | 718.1ºC at 760mmHg | |
| Molecular Formula | C14H17NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.1ºC | |
| Name | 2-[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.63g/cm3 |
|---|---|
| Boiling Point | 718.1ºC at 760mmHg |
| Molecular Formula | C14H17NO8 |
| Molecular Weight | 327.28700 |
| Flash Point | 388.1ºC |
| Exact Mass | 327.09500 |
| PSA | 156.55000 |
| Index of Refraction | 1.671 |
| InChIKey | BFMROEPNVMUGNL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)NC1C(O)OC(CO)C(O)C1O |
|
~%
a-D-Glucopyrano... CAS#:31505-42-7 |
| Literature: Landstroem, Jens; Bergstroem, Maria; Hamark, Christoffer; Ohlson, Sten; Widmalm, Goeran Organic and Biomolecular Chemistry, 2012 , vol. 10, # 15 p. 3019 - 3032 |
|
~61%
a-D-Glucopyrano... CAS#:31505-42-7 |
| Literature: Patel, Atula; Poller, Robert C. Recueil des Travaux Chimiques des Pays-Bas, 1988 , vol. 107, # 3 p. 182 - 184 |
| 2-(2-carboxybenzamido)-2-deoxy-D-glucopyranose |
| 2-desoxy-2-(2-carboxy)benzamido-D-glucose |
| 2-phthalamido-2-deoxy-D-glucopyranose |
| 2-(2-Carboxy-benzamido)-2-desoxy-D-glucose |