4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-dimethylaniline structure
|
Common Name | 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 3150-84-3 | Molecular Weight | 304.73200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2-chloro-4-nitrophenyl)diazenyl]-N,N-dimethylaniline |
|---|
| Molecular Formula | C14H13ClN4O2 |
|---|---|
| Molecular Weight | 304.73200 |
| Exact Mass | 304.07300 |
| PSA | 73.78000 |
| LogP | 5.25280 |
| InChIKey | GUMVUIYWNPHCHH-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2Cl)cc1 |
| HS Code | 2927000090 |
|---|
|
~%
4-[(2-chloro-4-... CAS#:3150-84-3 |
| Literature: L'OREAL Patent: WO2008/34650 A1, 2008 ; Location in patent: Page/Page column 47-48 ; |
|
~%
4-[(2-chloro-4-... CAS#:3150-84-3 |
| Literature: Nishimura; Kosako; Sueishi Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 6 p. 1617 - 1625 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |