b-D-Glucopyranoside, methyl2,3,4,6-tetra-O-methyl- structure
|
Common Name | b-D-Glucopyranoside, methyl2,3,4,6-tetra-O-methyl- | ||
|---|---|---|---|---|
| CAS Number | 3149-65-3 | Molecular Weight | 250.28900 | |
| Density | 1.07g/cm3 | Boiling Point | 305.2ºC at 760 mmHg | |
| Molecular Formula | C11H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.5ºC | |
| Name | Methyl tetra-O-methyl-.β.-D-glucoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 305.2ºC at 760 mmHg |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.28900 |
| Flash Point | 117.5ºC |
| Exact Mass | 250.14200 |
| PSA | 55.38000 |
| LogP | 0.04910 |
| Index of Refraction | 1.44 |
| InChIKey | ZYGZAHUNAGVTEC-PBPDKXIHSA-N |
| SMILES | COCC1OC(OC)C(OC)C(OC)C1OC |
| HS Code | 2932999099 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2,3,4,6-tetra-O-methylglucopyranoside |
| methyl 2,3,4,6-tetra-O-methyl-D-glucopyranoside |
| (2R,5R)-2,3,4,5-tetramethoxy-6-(methoxymethyl)oxane |