(Z)-4-chloro-N-(2,3-dichloro-4-oxonaphthalen-1(4H)-ylidene)benzamide
Modify Date: 2026-05-12 03:05:12
(Z)-4-chloro-N-(2,3-dichloro-4-oxonaphthalen-1(4H)-ylidene)benzamide structure
|
Common Name | (Z)-4-chloro-N-(2,3-dichloro-4-oxonaphthalen-1(4H)-ylidene)benzamide | ||
|---|---|---|---|---|
| CAS Number | 314751-09-2 | Molecular Weight | 364.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-4-chloro-N-(2,3-dichloro-4-oxonaphthalen-1(4H)-ylidene)benzamide |
|---|
| Molecular Formula | C17H8Cl3NO2 |
|---|---|
| Molecular Weight | 364.6 |
| InChIKey | ZAIZIWQGZUWGFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=O)C3=CC=C(C=C3)Cl)C(=C(C2=O)Cl)Cl |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1