3-{7-Chloro-2-[(1E,3E)-4-(5-nitro-furan-2-yl)-buta-1,3-dienyl]-quinolin-4-ylamino}-propan-1-ol; compound with phosphoric acid structure
|
Common Name | 3-{7-Chloro-2-[(1E,3E)-4-(5-nitro-furan-2-yl)-buta-1,3-dienyl]-quinolin-4-ylamino}-propan-1-ol; compound with phosphoric acid | ||
|---|---|---|---|---|
| CAS Number | 31432-70-9 | Molecular Weight | 497.82300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21ClN3O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-{7-Chloro-2-[(1E,3E)-4-(5-nitro-furan-2-yl)-buta-1,3-dienyl]-quinolin-4-ylamino}-propan-1-ol; compound with phosphoric acid |
|---|
| Molecular Formula | C20H21ClN3O8P |
|---|---|
| Molecular Weight | 497.82300 |
| Exact Mass | 497.07500 |
| PSA | 191.68000 |
| LogP | 4.57790 |
| InChIKey | KNIJVLQWWIGNJC-NFKFXXGOSA-N |
| SMILES | O=P(O)(O)O.O=P(O)(O)O.O=[N+]([O-])c1ccc(C=CC=Cc2cc(NCCCO)c3ccc(Cl)cc3n2)o1 |