(4-AMINO-1-METHYL-PYRROL-2-YL)-MORPHOLIN-4-YL-METHANONE
Modify Date: 2025-08-26 16:49:44
(4-AMINO-1-METHYL-PYRROL-2-YL)-MORPHOLIN-4-YL-METHANONE structure
|
Common Name | (4-AMINO-1-METHYL-PYRROL-2-YL)-MORPHOLIN-4-YL-METHANONE | ||
|---|---|---|---|---|
| CAS Number | 31431-26-2 | Molecular Weight | 260.22100 | |
| Density | 1.399g/cm3 | Boiling Point | 456.2ºC at 760mmHg | |
| Molecular Formula | C13H9FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.7ºC | |
| Name | (4-amino-3-nitrophenyl)-(4-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 456.2ºC at 760mmHg |
| Molecular Formula | C13H9FN2O3 |
| Molecular Weight | 260.22100 |
| Flash Point | 229.7ºC |
| Exact Mass | 260.06000 |
| PSA | 88.91000 |
| LogP | 3.65150 |
| Index of Refraction | 1.638 |
| InChIKey | WGHPYSRSLNIWOT-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2ccc(F)cc2)cc1[N+](=O)[O-] |
| HS Code | 2922399090 |
|---|
|
~%
(4-AMINO-1-METH... CAS#:31431-26-2 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 28, # 4 p. 586 - 594 |
|
~%
(4-AMINO-1-METH... CAS#:31431-26-2 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 28, # 4 p. 586 - 594 |
|
~%
(4-AMINO-1-METH... CAS#:31431-26-2 |
| Literature: Arzneimittel-Forschung/Drug Research, , vol. 28, # 4 p. 586 - 594 |
CAS#:66938-86-1![4-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]-2-nitroaniline structure](https://image.chemsrc.com/caspic/157/64420-30-0.png)
CAS#:64420-30-0| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Amino-3-nitro-4'-fluorobenzophenone |
| (4-amino-3-nitrophenyl)(4-fluorophenyl)methanone |
| EINECS 250-633-3 |
| 4-amino-4'-fluoro-3-nitrobenzophenone |
| 4-Amino-4'-fluor-3-nitrobenzophenon |