myo-Inositol,hexakis(dichloroacetate) (9CI)
Modify Date: 2025-08-25 11:51:24
myo-Inositol,hexakis(dichloroacetate) (9CI) structure
|
Common Name | myo-Inositol,hexakis(dichloroacetate) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 31429-11-5 | Molecular Weight | 845.71700 | |
| Density | 1.81g/cm3 | Boiling Point | 737.7ºC at 760 mmHg | |
| Molecular Formula | C18H12Cl12O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.1ºC | |
| Name | [2,3,4,5,6-pentakis[(2,2-dichloroacetyl)oxy]cyclohexyl] 2,2-dichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 737.7ºC at 760 mmHg |
| Molecular Formula | C18H12Cl12O12 |
| Molecular Weight | 845.71700 |
| Flash Point | 217.1ºC |
| Exact Mass | 839.65900 |
| PSA | 157.80000 |
| LogP | 4.29300 |
| Index of Refraction | 1.566 |
| InChIKey | TVNVHRYZXKXEPR-UHFFFAOYSA-N |
| SMILES | O=C(OC1C(OC(=O)C(Cl)Cl)C(OC(=O)C(Cl)Cl)C(OC(=O)C(Cl)Cl)C(OC(=O)C(Cl)Cl)C1OC(=O)C(Cl)Cl)C(Cl)Cl |
|
~%
myo-Inositol,he... CAS#:31429-11-5 |
| Literature: Sweeny,A. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 359 - 361 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| myo-Inositol,hexakis(dichloroacetate) (9CI) |
| cyclohexane-1,2,3,4,5,6-hexayl hexakis(dichloroacetate) |
| Inosit-hexakis-dichloracetat |