2-((2-(4-Chlorophenyl)-2-oxoethyl)thio)-3-ethyl-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one structure
|
Common Name | 2-((2-(4-Chlorophenyl)-2-oxoethyl)thio)-3-ethyl-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 314041-83-3 | Molecular Weight | 404.93 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 621.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C19H17ClN2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.7±34.3 °C | |
Use of 2-((2-(4-Chlorophenyl)-2-oxoethyl)thio)-3-ethyl-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-oneinhibition of hedgehog signaling and phosphodiesterase; inhibition of hedgehog signaling and phosphodiesterase. |
| Name | WAY-313170 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 621.5±65.0 °C at 760 mmHg |
| Molecular Formula | C19H17ClN2O2S2 |
| Molecular Weight | 404.93 |
| Flash Point | 329.7±34.3 °C |
| Exact Mass | 404.041992 |
| LogP | 5.00 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | VCFUQXJBIOJXMV-UHFFFAOYSA-N |
| SMILES | CCn1c(SCC(=O)c2ccc(Cl)cc2)nc2sc3c(c2c1=O)CCC3 |
| 2-{[2-(4-Chlorophenyl)-2-oxoethyl]sulfanyl}-3-ethyl-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one |
| 4H-Cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one, 2-[[2-(4-chlorophenyl)-2-oxoethyl]thio]-3-ethyl-3,5,6,7-tetrahydro- |