3 3 3-TRIFLUORO-1-PHENYL-1 2-PROPANEDIO& structure
|
Common Name | 3 3 3-TRIFLUORO-1-PHENYL-1 2-PROPANEDIO& | ||
|---|---|---|---|---|
| CAS Number | 314041-39-9 | Molecular Weight | 220.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3O3 | Melting Point | 80-83ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,3-trifluoro-1-phenylpropane-1,2-dione,hydrate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 80-83ºC(lit.) |
|---|---|
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.14500 |
| Exact Mass | 220.03500 |
| PSA | 43.37000 |
| LogP | 1.93640 |
| InChIKey | PSKYXWMZYBYVDK-UHFFFAOYSA-N |
| SMILES | O.O=C(C(=O)C(F)(F)F)c1ccccc1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 3,3,3-trifluoro-1-phenylpropane-1,2-dione hydrate |
| 3,3,3-trifluoro-1-phenyl-1,2-propanedione hydrate |
| 1-phenyl-3,3,3-trifluoro-1,2-propanedione monohydrate |