5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide
Modify Date: 2025-11-30 18:18:58
5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide structure
|
Common Name | 5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 314022-39-4 | Molecular Weight | 360.58800 | |
| Density | 1.586g/cm3 | Boiling Point | 375.4ºC at 760 mmHg | |
| Molecular Formula | C13H11BrClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.8ºC | |
| Name | 5-bromo-N-(4-chloro-2,5-dimethoxyphenyl)furan-2-carboxamide |
|---|
| Density | 1.586g/cm3 |
|---|---|
| Boiling Point | 375.4ºC at 760 mmHg |
| Molecular Formula | C13H11BrClNO4 |
| Molecular Weight | 360.58800 |
| Flash Point | 180.8ºC |
| Exact Mass | 358.95600 |
| PSA | 60.70000 |
| LogP | 4.03800 |
| Index of Refraction | 1.612 |
| InChIKey | LPIWYXBQNUZQQT-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)c2ccc(Br)o2)c(OC)cc1Cl |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |