Ethanone,1-(4-bromophenyl)-2-[(4-methylphenyl)sulfonyl]- structure
|
Common Name | Ethanone,1-(4-bromophenyl)-2-[(4-methylphenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 31377-97-6 | Molecular Weight | 353.23100 | |
| Density | 1.474g/cm3 | Boiling Point | 533.5ºC at 760 mmHg | |
| Molecular Formula | C15H13BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.4ºC | |
| Name | 1-(4-bromophenyl)-2-(toluene-4-sulfonyl)ethanone |
|---|
| Density | 1.474g/cm3 |
|---|---|
| Boiling Point | 533.5ºC at 760 mmHg |
| Molecular Formula | C15H13BrO3S |
| Molecular Weight | 353.23100 |
| Flash Point | 276.4ºC |
| Exact Mass | 351.97700 |
| PSA | 59.59000 |
| LogP | 4.49490 |
| Index of Refraction | 1.6 |
| InChIKey | JGMRIHQYBXLTGM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)c2ccc(Br)cc2)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |