1,3-Cyclohexanedicarboxylicacid,5-amino-(9CI)
Modify Date: 2025-09-18 12:33:27
1,3-Cyclohexanedicarboxylicacid,5-amino-(9CI) structure
|
Common Name | 1,3-Cyclohexanedicarboxylicacid,5-amino-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 313683-55-5 | Molecular Weight | 187.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-aminocyclohexane-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H13NO4 |
|---|---|
| Molecular Weight | 187.19300 |
| Exact Mass | 187.08400 |
| PSA | 100.62000 |
| LogP | 0.59950 |
| InChIKey | XRHDGTKEPGEJDD-UHFFFAOYSA-N |
| SMILES | NC1CC(C(=O)O)CC(C(=O)O)C1 |
| HS Code | 2922499990 |
|---|
|
~%
1,3-Cyclohexane... CAS#:313683-55-5 |
| Literature: Elan Pharmaceuticals, Inc. Patent: US7169759 B1, 2007 ; Location in patent: Page/Page column 11; 23-24 ; US 7169759 B1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 1,3-Cyclohexanedicarboxylicacid,5-amino |
| 3,5-dicarboxycyclohexylamine |