5,6-dimethoxy-1H-indole-3-ethylamine
Modify Date: 2025-08-27 18:28:30
5,6-dimethoxy-1H-indole-3-ethylamine structure
|
Common Name | 5,6-dimethoxy-1H-indole-3-ethylamine | ||
|---|---|---|---|---|
| CAS Number | 31363-68-5 | Molecular Weight | 220.26800 | |
| Density | 1.181g/cm3 | Boiling Point | 399.5ºC at 760mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.4ºC | |
| Name | 2-(5,6-Dimethoxy-1H-indol-3-yl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 399.5ºC at 760mmHg |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Flash Point | 195.4ºC |
| Exact Mass | 220.12100 |
| PSA | 60.27000 |
| LogP | 2.38660 |
| Index of Refraction | 1.614 |
| InChIKey | RUBWDHXESZEALO-UHFFFAOYSA-N |
| SMILES | COc1cc2[nH]cc(CCN)c2cc1OC |
| HS Code | 2933990090 |
|---|
|
~%
5,6-dimethoxy-1... CAS#:31363-68-5 |
| Literature: Tan; Dun-Xian; Reiter; Russel Joseph; Yan; Mei-ting Patent: US6114373 A1, 2000 ; |
|
~%
5,6-dimethoxy-1... CAS#:31363-68-5 |
| Literature: Huebner et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 5887,5890 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 250-590-0 |
| 5,6-Dimethoxy-1H-indole-3-ethylamine |
| 2-(5,6-dimethoxy-indol-3-yl)-ethylamine |
| 5,6-Dimethoxy-tryptamin |
| 5,6-dimethoxytryptamine |
| 2-(5,6-Dimethoxy-indol-3-yl)-aethylamin |