2-bromo-6-ethoxy-4-(2-nitroprop-1-enyl)phenol
Modify Date: 2025-11-30 20:00:23
2-bromo-6-ethoxy-4-(2-nitroprop-1-enyl)phenol structure
|
Common Name | 2-bromo-6-ethoxy-4-(2-nitroprop-1-enyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 312510-61-5 | Molecular Weight | 302.12100 | |
| Density | 1.524g/cm3 | Boiling Point | 375.1ºC at 760 mmHg | |
| Molecular Formula | C11H12BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.7ºC | |
| Name | 2-bromo-6-ethoxy-4-(2-nitroprop-1-enyl)phenol |
|---|
| Density | 1.524g/cm3 |
|---|---|
| Boiling Point | 375.1ºC at 760 mmHg |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12100 |
| Flash Point | 180.7ºC |
| Exact Mass | 300.99500 |
| PSA | 75.28000 |
| LogP | 3.71410 |
| Index of Refraction | 1.612 |
| InChIKey | QBELTRFFIQGQOT-QPJJXVBHSA-N |
| SMILES | CCOc1cc(C=C(C)[N+](=O)[O-])cc(Br)c1O |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |