(2R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propan oic acid-(1R)-1-phenylethanamine (1:1)
Modify Date: 2025-08-23 11:51:12
![(2R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propan oic acid-(1R)-1-phenylethanamine (1:1) Structure](https://image.chemsrc.com/caspic/030/312493-43-9.png)
(2R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propan oic acid-(1R)-1-phenylethanamine (1:1) structure
|
Common Name | (2R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propan oic acid-(1R)-1-phenylethanamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 312493-43-9 | Molecular Weight | 324.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-2-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propan oic acid-(1R)-1-phenylethanamine (1:1) |
|---|
| Molecular Formula | C17H28N2O4 |
|---|---|
| Molecular Weight | 324.41500 |
| Exact Mass | 324.20500 |
| PSA | 105.14000 |
| LogP | 3.84280 |
| InChIKey | RPSCZYNEHWIARJ-XTFNENAJSA-N |
| SMILES | CC(CNC(=O)OC(C)(C)C)C(=O)O.CC(N)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~64%
(2R)-2-Methyl-3... CAS#:312493-43-9 |
| Literature: ELI LILLY AND COMPANY Patent: WO2004/108677 A1, 2004 ; Location in patent: Page 132-133 ; WO 2004/108677 A1 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |