trimethyl-[4-(trifluoromethyl)phenyl]silane structure
|
Common Name | trimethyl-[4-(trifluoromethyl)phenyl]silane | ||
|---|---|---|---|---|
| CAS Number | 312-75-4 | Molecular Weight | 218.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13F3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[4-(trifluoromethyl)phenyl]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13F3Si |
|---|---|
| Molecular Weight | 218.29100 |
| Exact Mass | 218.07400 |
| LogP | 3.25060 |
| InChIKey | IEFGJDFUBXVNJI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1ccc(C(F)(F)F)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Me3SiC6H4-p-CF3 |
| p-CF3C6H4SiMe3 |