Benzenesulfonylfluoride, 4-[4-(2-chloro-5-nitrophenoxy)butoxy]-
Modify Date: 2025-08-28 17:45:30
![Benzenesulfonylfluoride, 4-[4-(2-chloro-5-nitrophenoxy)butoxy]- Structure](https://image.chemsrc.com/caspic/403/31185-45-2.png)
Benzenesulfonylfluoride, 4-[4-(2-chloro-5-nitrophenoxy)butoxy]- structure
|
Common Name | Benzenesulfonylfluoride, 4-[4-(2-chloro-5-nitrophenoxy)butoxy]- | ||
|---|---|---|---|---|
| CAS Number | 31185-45-2 | Molecular Weight | 403.81000 | |
| Density | 1.412g/cm3 | Boiling Point | 549.6ºC at 760mmHg | |
| Molecular Formula | C16H15ClFNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.2ºC | |
| Name | 4-[4-(2-chloro-5-nitrophenoxy)butoxy]benzenesulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 549.6ºC at 760mmHg |
| Molecular Formula | C16H15ClFNO6S |
| Molecular Weight | 403.81000 |
| Flash Point | 286.2ºC |
| Exact Mass | 403.02900 |
| PSA | 106.80000 |
| LogP | 5.74840 |
| Index of Refraction | 1.566 |
| InChIKey | NCYSKIOGBRPBDO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(OCCCCOc2ccc(S(=O)(=O)F)cc2)c1 |
|
~%
Benzenesulfonyl... CAS#:31185-45-2 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
|
~%
Benzenesulfonyl... CAS#:31185-45-2 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonylfluoride,4-[4-(2-chloro-5-nitrophenoxy)butoxy] |