Benzenesulfonylfluoride, 4-[2-(2-chloro-5-nitrophenoxy)ethoxy]-
Modify Date: 2025-09-17 15:00:47
![Benzenesulfonylfluoride, 4-[2-(2-chloro-5-nitrophenoxy)ethoxy]- Structure](https://image.chemsrc.com/caspic/479/31185-43-0.png)
Benzenesulfonylfluoride, 4-[2-(2-chloro-5-nitrophenoxy)ethoxy]- structure
|
Common Name | Benzenesulfonylfluoride, 4-[2-(2-chloro-5-nitrophenoxy)ethoxy]- | ||
|---|---|---|---|---|
| CAS Number | 31185-43-0 | Molecular Weight | 375.75700 | |
| Density | 1.486g/cm3 | Boiling Point | 525.1ºC at 760mmHg | |
| Molecular Formula | C14H11ClFNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.4ºC | |
| Name | 4-[2-(2-chloro-5-nitrophenoxy)ethoxy]benzenesulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 525.1ºC at 760mmHg |
| Molecular Formula | C14H11ClFNO6S |
| Molecular Weight | 375.75700 |
| Flash Point | 271.4ºC |
| Exact Mass | 374.99800 |
| PSA | 106.80000 |
| LogP | 4.96820 |
| Index of Refraction | 1.578 |
| InChIKey | DUSXLDPLAQTQDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCOC2=C(C=CC(=C2)[N+](=O)[O-])Cl)S(=O)(=O)F |
|
~%
Benzenesulfonyl... CAS#:31185-43-0 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
|
~%
Benzenesulfonyl... CAS#:31185-43-0 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonylfluoride,4-[2-(2-chloro-5-nitrophenoxy)ethoxy] |
| 1-(2-Chlor-5-nitrophenoxy)-2-(4-fluorsulfonyl-phenoxy)-ethan |