Benzenesulfonylfluoride, 4-[[4-[(2-chloro-4-nitrophenoxy)methyl]phenyl]methoxy]- structure
|
Common Name | Benzenesulfonylfluoride, 4-[[4-[(2-chloro-4-nitrophenoxy)methyl]phenyl]methoxy]- | ||
|---|---|---|---|---|
| CAS Number | 31185-39-4 | Molecular Weight | 451.85300 | |
| Density | 1.441g/cm3 | Boiling Point | 594.9ºC at 760mmHg | |
| Molecular Formula | C20H15ClFNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.6ºC | |
| Name | 4-[[4-[(2-chloro-4-nitrophenoxy)methyl]phenyl]methoxy]benzenesulfonyl fluoride |
|---|
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 594.9ºC at 760mmHg |
| Molecular Formula | C20H15ClFNO6S |
| Molecular Weight | 451.85300 |
| Flash Point | 313.6ºC |
| Exact Mass | 451.02900 |
| PSA | 106.80000 |
| LogP | 6.66840 |
| Index of Refraction | 1.61 |
| InChIKey | KVQFYRQDSSXKGX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccc(COc3ccc(S(=O)(=O)F)cc3)cc2)c(Cl)c1 |
|
~%
Benzenesulfonyl... CAS#:31185-39-4 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
|
~%
Benzenesulfonyl... CAS#:31185-39-4 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
|
~%
Benzenesulfonyl... CAS#:31185-39-4 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |