3-(1-ethoxyethoxy)-3,7-dimethyloct-6-ene-1-yne
Modify Date: 2025-09-24 20:05:51
3-(1-ethoxyethoxy)-3,7-dimethyloct-6-ene-1-yne structure
|
Common Name | 3-(1-ethoxyethoxy)-3,7-dimethyloct-6-ene-1-yne | ||
|---|---|---|---|---|
| CAS Number | 31180-77-5 | Molecular Weight | 224.33900 | |
| Density | 0.897g/cm3 | Boiling Point | 281.5ºC at 760mmHg | |
| Molecular Formula | C14H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.1ºC | |
| Name | 3-(1-ethoxyethoxy)-3,7-dimethyloct-6-en-1-yne |
|---|---|
| Synonym | More Synonyms |
| Density | 0.897g/cm3 |
|---|---|
| Boiling Point | 281.5ºC at 760mmHg |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.33900 |
| Flash Point | 88.1ºC |
| Exact Mass | 224.17800 |
| PSA | 18.46000 |
| LogP | 3.52380 |
| Index of Refraction | 1.456 |
| InChIKey | CGENMIVCMHPWGS-UHFFFAOYSA-N |
| SMILES | C#CC(C)(CCC=C(C)C)OC(C)OCC |
| HS Code | 2909199090 |
|---|
|
~%
3-(1-ethoxyetho... CAS#:31180-77-5 |
| Literature: Hoffmann-La Roche Patent: US2861109 , 1956 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Acetaldehyd-dehydrolinalyl-ethyl-acetal |
| EINECS 250-503-6 |
| 7,9-Dioxa-2,6,8-trimethyl-6-ethynyl-2-undecene |