2-methoxy-6-[(4-methoxyanilino)methylidene]cyclohexa-2,4-dien-1-one
Modify Date: 2024-02-01 18:24:42
![2-methoxy-6-[(4-methoxyanilino)methylidene]cyclohexa-2,4-dien-1-one Structure](https://image.chemsrc.com/caspic/390/3117-64-4.png)
2-methoxy-6-[(4-methoxyanilino)methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 2-methoxy-6-[(4-methoxyanilino)methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 3117-64-4 | Molecular Weight | 257.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methoxy-6-[(4-methoxyanilino)methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15NO3 |
|---|---|
| Molecular Weight | 257.28400 |
| Exact Mass | 257.10500 |
| PSA | 47.56000 |
| LogP | 2.73320 |
| InChIKey | YYMVRDPHQOMSFJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=Cc2cccc(OC)c2O)cc1 |
| HS Code | 2925290090 |
|---|
|
~80%
2-methoxy-6-[(4... CAS#:3117-64-4 |
| Literature: Tripathi, Namrata; Shalini; Sharma Polish Journal of Chemistry, 2008 , vol. 82, # 3 p. 523 - 535 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| o-vanillin para-anisidine |
| 3-Methoxy-2-hydroxybenzyliden-p-methoxyanilin |