Phosphine oxide,dihexyloctyl- structure
|
Common Name | Phosphine oxide,dihexyloctyl- | ||
|---|---|---|---|---|
| CAS Number | 31160-64-2 | Molecular Weight | 330.52900 | |
| Density | 0.863g/cm3 | Boiling Point | 455.2ºC at 760 mmHg | |
| Molecular Formula | C20H43OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.1ºC | |
| Name | 1-dihexylphosphoryloctane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.863g/cm3 |
|---|---|
| Boiling Point | 455.2ºC at 760 mmHg |
| Molecular Formula | C20H43OP |
| Molecular Weight | 330.52900 |
| Flash Point | 229.1ºC |
| Exact Mass | 330.30500 |
| PSA | 26.88000 |
| LogP | 7.87060 |
| Index of Refraction | 1.443 |
| InChIKey | XHRRUIJGMKIISX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCP(=O)(CCCCCC)CCCCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trialkylphosphine oxide |
| Octyldihexylphosphine oxide |
| di-n-hexyl-n-octylphosphine oxide |
| Phosphine oxide,dihexyloctyl |
| Dihexyl(Octyl)Phosphine Oxide |
| Phosphine oxide, dihexyloctyl- |