(4-Nonylphenoxy)acetic acid structure
|
Common Name | (4-Nonylphenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 3115-49-9 | Molecular Weight | 278.387 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 406.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C17H26O3 | Melting Point | 95-97ºC | |
| MSDS | N/A | Flash Point | 140.1±15.3 °C | |
| Name | 2-(4-nonylphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.8±20.0 °C at 760 mmHg |
| Melting Point | 95-97ºC |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.387 |
| Flash Point | 140.1±15.3 °C |
| Exact Mass | 278.188202 |
| PSA | 46.53000 |
| LogP | 6.05 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | NISAHDHKGPWBEM-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1ccc(OCC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-nonylphenoxy)ethanoic acid |
| (Nonylphenoxy)acetic acid |
| Acetic acid, 2-(4-nonylphenoxy)- |
| Acetic acid, (4-nonylphenoxy)- |
| 4-nonylphenolmonoethoxycarboxylate |
| (4-Nonylphenoxy)acetic acid |
| 2-(3,4-DIFLUOROPHENYL)CYCLOPROPANE AMINE ( RACEMATE) |
| Acetic acid,(4-nonylphenoxy) |
| (p-Nonylphenoxy)acetic acid |