dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol,propane-1,2,3-triol
Modify Date: 2025-08-31 17:16:52
dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol,propane-1,2,3-triol structure
|
Common Name | dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol,propane-1,2,3-triol | ||
|---|---|---|---|---|
| CAS Number | 31135-71-4 | Molecular Weight | 348.34600 | |
| Density | N/A | Boiling Point | 285ºC at 760mmHg | |
| Molecular Formula | C15H24O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148ºC | |
| Name | dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol,propane-1,2,3-triol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 285ºC at 760mmHg |
|---|---|
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.34600 |
| Flash Point | 148ºC |
| Exact Mass | 348.14200 |
| PSA | 153.75000 |
| InChIKey | MUFPWVDQKXFHIT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)cc1.OCC(O)CO.OCCO |
| Dimethyl terephthalate,ethylene glycol,glycerin polymer |
| 1,4-Benzenedicarboxylic acid,dimethyl ester,polymer with 1,2-ethanediol and 1,2,3-propanetriol |
| Ethylene glycol,dimethyl terephthalate,glycerol polymer |