Ethyl 4-chloro-5,7-difluoroquinoline-3-carboxylate structure
|
Common Name | Ethyl 4-chloro-5,7-difluoroquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 311346-69-7 | Molecular Weight | 271.64700 | |
| Density | 1.418g/cm3 | Boiling Point | 329.9ºC at 760mmHg | |
| Molecular Formula | C12H8ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3ºC | |
| Name | ethyl 1-chloro-6,8-difluoro-2H-quinoxaline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 329.9ºC at 760mmHg |
| Molecular Formula | C12H8ClF2NO2 |
| Molecular Weight | 271.64700 |
| Flash Point | 153.3ºC |
| Exact Mass | 271.02100 |
| PSA | 39.19000 |
| LogP | 3.34310 |
| Index of Refraction | 1.576 |
| InChIKey | IEGYWXRVOVIAMV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2cc(F)cc(F)c2c1Cl |
| HS Code | 2933499090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00173416 |
| 3-Quinolinecarboxylicacid,4-chloro-5,7-difluoro-,ethyl ester |
| ethyl 4-chloro-5,7-difluoroquinoline-3-carboxylate |