N-[4-(2-Diethylamino-ethoxy)-phenyl]-N'-phenyl-benzamidine; compound with oxalic acid structure
|
Common Name | N-[4-(2-Diethylamino-ethoxy)-phenyl]-N'-phenyl-benzamidine; compound with oxalic acid | ||
|---|---|---|---|---|
| CAS Number | 31109-75-8 | Molecular Weight | 477.55200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H31N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(2-Diethylamino-ethoxy)-phenyl]-N'-phenyl-benzamidine; compound with oxalic acid |
|---|
| Molecular Formula | C27H31N3O5 |
|---|---|
| Molecular Weight | 477.55200 |
| Exact Mass | 477.22600 |
| PSA | 111.46000 |
| LogP | 4.82620 |
| InChIKey | KHKBLZPOCJGRBI-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc(N=C(Nc2ccccc2)c2ccccc2)cc1.O=C(O)C(=O)O |