N-(4-chloro-3-methylphenyl)-1-(2-methylprop-2-enyl)pyrrolidin-2-imine
Modify Date: 2025-09-24 17:35:28
N-(4-chloro-3-methylphenyl)-1-(2-methylprop-2-enyl)pyrrolidin-2-imine structure
|
Common Name | N-(4-chloro-3-methylphenyl)-1-(2-methylprop-2-enyl)pyrrolidin-2-imine | ||
|---|---|---|---|---|
| CAS Number | 31079-53-5 | Molecular Weight | 262.77800 | |
| Density | 1.09g/cm3 | Boiling Point | 382.3ºC at 760mmHg | |
| Molecular Formula | C15H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | N-(4-chloro-3-methylphenyl)-1-(2-methylprop-2-enyl)pyrrolidin-2-imine |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 382.3ºC at 760mmHg |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.77800 |
| Flash Point | 185ºC |
| Exact Mass | 262.12400 |
| PSA | 15.60000 |
| LogP | 4.28820 |
| Index of Refraction | 1.562 |
| InChIKey | SUCCMMMFLRAIMR-UHFFFAOYSA-N |
| SMILES | C=C(C)CN1CCCC1=Nc1ccc(Cl)c(C)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |