Acetamide,N-[4-[3-(4-nitrophenoxy)propoxy]phenyl]- structure
|
Common Name | Acetamide,N-[4-[3-(4-nitrophenoxy)propoxy]phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 31066-21-4 | Molecular Weight | 330.33500 | |
| Density | 1.271g/cm3 | Boiling Point | 572.7ºC at 760 mmHg | |
| Molecular Formula | C17H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.2ºC | |
| Name | N-[4-[3-(4-nitrophenoxy)propoxy]phenyl]acetamide |
|---|
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 572.7ºC at 760 mmHg |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.33500 |
| Flash Point | 300.2ºC |
| Exact Mass | 330.12200 |
| PSA | 93.38000 |
| LogP | 3.99730 |
| Index of Refraction | 1.603 |
| InChIKey | LKNQELBAUNDHHF-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(OCCCOc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
Acetamide,N-[4-... CAS#:31066-21-4 |
| Literature: Baker; Vermeulen Journal of medicinal chemistry, 1970 , vol. 13, # 6 p. 1143 - 1148 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |