2-Furancarboxylic acid,5,5'-methylenebis-, diethyl ester (9CI) structure
|
Common Name | 2-Furancarboxylic acid,5,5'-methylenebis-, diethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 30990-15-9 | Molecular Weight | 292.28400 | |
| Density | 1.201g/cm3 | Boiling Point | 413.3ºC at 760 mmHg | |
| Molecular Formula | C15H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | ethyl 5-[(5-ethoxycarbonylfuran-2-yl)methyl]furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 413.3ºC at 760 mmHg |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.28400 |
| Flash Point | 203.7ºC |
| Exact Mass | 292.09500 |
| PSA | 78.88000 |
| LogP | 2.81680 |
| Index of Refraction | 1.511 |
| InChIKey | SVGLNEWMLNSOKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(Cc2ccc(C(=O)OCC)o2)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5,5'-methanediyl-bis-furan-2-carboxylic acid diethyl ester |
| diethyl 5,5'-methanediyldifuran-2-carboxylate |