CHEMBRDG-BB 5856620
Modify Date: 2025-09-17 19:20:09
CHEMBRDG-BB 5856620 structure
|
Common Name | CHEMBRDG-BB 5856620 | ||
|---|---|---|---|---|
| CAS Number | 309280-14-6 | Molecular Weight | 222.30700 | |
| Density | 1.21g/cm3 | Boiling Point | 360.8ºC at 760 mmHg | |
| Molecular Formula | C11H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172ºC | |
| Name | 1-cyclopropyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 360.8ºC at 760 mmHg |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.30700 |
| Flash Point | 172ºC |
| Exact Mass | 222.08300 |
| PSA | 68.15000 |
| LogP | 2.16460 |
| Index of Refraction | 1.579 |
| InChIKey | RBETWEFFJPQBFE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(SCC(=O)C2CC2)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms1554g01 |