2-oxo-2-[[2-(2-oxoimidazolidin-1-yl)ethyl]amino]ethyl methacrylate structure
|
Common Name | 2-oxo-2-[[2-(2-oxoimidazolidin-1-yl)ethyl]amino]ethyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 3089-23-4 | Molecular Weight | 255.27000 | |
| Density | 1.197g/cm3 | Boiling Point | 558ºC at 760mmHg | |
| Molecular Formula | C11H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.3ºC | |
| Name | [2-oxo-2-[2-(2-oxoimidazolidin-1-yl)ethylamino]ethyl] 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 558ºC at 760mmHg |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27000 |
| Flash Point | 291.3ºC |
| Exact Mass | 255.12200 |
| PSA | 94.72000 |
| Index of Refraction | 1.502 |
| InChIKey | BMMZGRLRFPSWKY-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(=O)NCCN1CCNC1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 221-428-6 |