4,11-dichloro-5,12-dihydroquino[2,3-b]acridine-7,14-dione structure
|
Common Name | 4,11-dichloro-5,12-dihydroquino[2,3-b]acridine-7,14-dione | ||
|---|---|---|---|---|
| CAS Number | 3089-16-5 | Molecular Weight | 381.21200 | |
| Density | 1.514g/cm3 | Boiling Point | 619.8ºC at 760mmHg | |
| Molecular Formula | C20H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.6ºC | |
| Name | 4,11-dichloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.514g/cm3 |
|---|---|
| Boiling Point | 619.8ºC at 760mmHg |
| Molecular Formula | C20H10Cl2N2O2 |
| Molecular Weight | 381.21200 |
| Flash Point | 328.6ºC |
| Exact Mass | 380.01200 |
| PSA | 65.72000 |
| LogP | 4.98280 |
| Index of Refraction | 1.707 |
| InChIKey | BFEJTCHFLJECJN-UHFFFAOYSA-N |
| SMILES | O=c1c2cc3[nH]c4c(Cl)cccc4c(=O)c3cc2[nH]c2c(Cl)cccc12 |
| HS Code | 2933990090 |
|---|
|
~%
4,11-dichloro-5... CAS#:3089-16-5 |
| Literature: MCA TECHNOLOGIES GMBH Patent: WO2005/85364 A1, 2005 ; Location in patent: Page/Page column 19 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,11-Dichlor-chinacridon |
| Quinacridone,4,11-dichloro |
| EINECS 221-423-9 |
| 4,11-dichloroquinacridone |