diethyl (7-methyl-17-oxo-15,16-dihydrocyclopenta[a]phenanthren-11-yl) phosphate
Modify Date: 2025-09-19 19:21:07
![diethyl (7-methyl-17-oxo-15,16-dihydrocyclopenta[a]phenanthren-11-yl) phosphate Structure](https://image.chemsrc.com/caspic/337/30835-64-4.png)
diethyl (7-methyl-17-oxo-15,16-dihydrocyclopenta[a]phenanthren-11-yl) phosphate structure
|
Common Name | diethyl (7-methyl-17-oxo-15,16-dihydrocyclopenta[a]phenanthren-11-yl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 30835-64-4 | Molecular Weight | 398.38900 | |
| Density | 1.285g/cm3 | Boiling Point | 549.5ºC at 760 mmHg | |
| Molecular Formula | C22H23O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299ºC | |
| Name | diethyl (7-methyl-17-oxo-15,16-dihydrocyclopenta[a]phenanthren-11-yl) phosphate |
|---|
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 549.5ºC at 760 mmHg |
| Molecular Formula | C22H23O5P |
| Molecular Weight | 398.38900 |
| Flash Point | 299ºC |
| Exact Mass | 398.12800 |
| PSA | 71.64000 |
| LogP | 5.99020 |
| Index of Refraction | 1.628 |
| InChIKey | XVJNDKZYUIAPOF-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)Oc1cc2c(c3c(C)cc4ccccc4c13)CCC2=O |
|
~%
diethyl (7-meth... CAS#:30835-64-4 |
| Literature: Coombs,M.M.; Jaitly,S.B. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 230 - 234 |
|
~%
diethyl (7-meth... CAS#:30835-64-4 |
| Literature: Coombs,M.M.; Jaitly,S.B. Journal of the Chemical Society [Section] C: Organic, 1971 , p. 230 - 234 |
![7-methyl-17-oxo-16,17-dihydro-15H-cyclopenta[a]phenanthren-11-yl acetate structure](https://image.chemsrc.com/caspic/224/30856-55-4.png)
![11-hydroxy-7-methyl-15,16-dihydrocyclopenta[a]phenanthren-17-one structure](https://image.chemsrc.com/caspic/489/30835-60-0.png)
CAS#:30835-65-5