4-Thiazolecarboxylicacid, 2-[2-(benzoylamino)ethyl]-, ethyl ester structure
|
Common Name | 4-Thiazolecarboxylicacid, 2-[2-(benzoylamino)ethyl]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 30761-31-0 | Molecular Weight | 304.36400 | |
| Density | 1.246g/cm3 | Boiling Point | 516.5ºC at 760mmHg | |
| Molecular Formula | C15H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.2ºC | |
| Name | ethyl 2-(2-benzamidoethyl)-1,3-thiazole-4-carboxylate |
|---|
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 516.5ºC at 760mmHg |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.36400 |
| Flash Point | 266.2ºC |
| Exact Mass | 304.08800 |
| PSA | 96.53000 |
| LogP | 2.68320 |
| Index of Refraction | 1.585 |
| InChIKey | KPCFTYLQQPYXOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)CCNC(=O)C2=CC=CC=C2 |
| HS Code | 2934100090 |
|---|
|
~%
4-Thiazolecarbo... CAS#:30761-31-0 |
| Literature: Zee-Cheng,K.Y.; Cheng,C.C. Journal of Heterocyclic Chemistry, 1970 , vol. 7, p. 1439 - 1440 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |