1 3 5 7 9 11 14-HEPTAISOBUTYLTRICYCLO structure
|
Common Name | 1 3 5 7 9 11 14-HEPTAISOBUTYLTRICYCLO | ||
|---|---|---|---|---|
| CAS Number | 307531-92-6 | Molecular Weight | 791.41500 | |
| Density | 1.08g/cm3 | Boiling Point | 560.9ºC at 760 mmHg | |
| Molecular Formula | C28H66O12Si7 | Melting Point | 139-143ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 293ºC | |
| Name | 1,3,5,7,9,11,14-Heptaisobutyltricyclo[7.3.3.15,11]heptasiloxane-endo-3,7,14-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 560.9ºC at 760 mmHg |
| Melting Point | 139-143ºC(lit.) |
| Molecular Formula | C28H66O12Si7 |
| Molecular Weight | 791.41500 |
| Flash Point | 293ºC |
| Exact Mass | 790.29400 |
| PSA | 143.76000 |
| LogP | 6.31780 |
| Index of Refraction | 1.48 |
| InChIKey | APIBTMSFBUJAAC-UHFFFAOYSA-N |
| SMILES | CC(C)C[Si]1(O)O[Si]2(CC(C)C)O[Si](O)(CC(C)C)O[Si]3(CC(C)C)O[Si](O)(CC(C)C)O[Si](CC(C)C)(O1)O[Si](CC(C)C)(O2)O3 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~72%
1 3 5 7 9 11 14... CAS#:307531-92-6 |
| Literature: Zhou, Jinlan; Zhao, Yongchen; Yu, Kaichao; Zhou, Xingping; Xie, Xiaolin New Journal of Chemistry, 2011 , vol. 35, # 12 p. 2781 - 2792 |
| trisilanoisobutyl-POSS |
| tricyclo[7.3.3.15,11]heptasiloxane-3,7,14-triol-1,3,5,7,9,11,14-heptakis(2-methylpropyl) |
| 1,3,5,7,9,11,14-heptaisobutyltricyclo[7.3.3.1(5,11)]heptasiloxane-endo-3,7,14-triol |
| isobutyl silsesquioxane |
| Isobutyltrisilanol-POSS(R) |
| trisilanol-iBu-POSS |
| MFCD02683450 |
| 1,3,5,7,9,11,14-heptaisobutyltricyclo[7,3,3,1(5,14)]heptasiloxane-3,7,11-trisilanol |