3,5-Cyclohexadiene-1,2-dione,4,5-bis[(4-chlorophenyl)amino]- structure
|
Common Name | 3,5-Cyclohexadiene-1,2-dione,4,5-bis[(4-chlorophenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 30725-06-5 | Molecular Weight | 359.20600 | |
| Density | 1.523g/cm3 | Boiling Point | 447.3ºC at 760 mmHg | |
| Molecular Formula | C18H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | 4,5-bis(4-chloroanilino)cyclohexa-3,5-diene-1,2-dione |
|---|
| Density | 1.523g/cm3 |
|---|---|
| Boiling Point | 447.3ºC at 760 mmHg |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.20600 |
| Flash Point | 224.3ºC |
| Exact Mass | 358.02800 |
| PSA | 58.20000 |
| LogP | 4.58300 |
| Index of Refraction | 1.742 |
| InChIKey | RCSHWKBJFRDLQE-UHFFFAOYSA-N |
| SMILES | O=C1C=C(Nc2ccc(Cl)cc2)C(Nc2ccc(Cl)cc2)=CC1=O |
|
~%
3,5-Cyclohexadi... CAS#:30725-06-5 |
| Literature: Barry et al. Journal of the Chemical Society, 1958 , p. 859 Journal of the Chemical Society, 1956 , p. 3347,3349 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |