5-Pyrimidinecarboxylicacid, 1-cyclohexyl-1,2,3,4-tetrahydro-2,4-dioxo- structure
|
Common Name | 5-Pyrimidinecarboxylicacid, 1-cyclohexyl-1,2,3,4-tetrahydro-2,4-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 30695-22-8 | Molecular Weight | 238.24000 | |
| Density | 1.399g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyclohexyl-2,4-dioxopyrimidine-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24000 |
| Exact Mass | 238.09500 |
| PSA | 92.16000 |
| LogP | 0.74000 |
| Index of Refraction | 1.585 |
| InChIKey | KTNLKAVTJAHRDK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cn(C2CCCCC2)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Cyclohexyl-5-Carboxyuracil |
| 1-cyclohexyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid |