5-[4-(tert-butyl)phenyl]-1,3,4-oxadiazole-2-thiol structure
|
Common Name | 5-[4-(tert-butyl)phenyl]-1,3,4-oxadiazole-2-thiol | ||
|---|---|---|---|---|
| CAS Number | 306936-90-3 | Molecular Weight | 234.31700 | |
| Density | 1.19 g/cm3 | Boiling Point | 295.8ºC at 760 mmHg | |
| Molecular Formula | C12H14N2OS | Melting Point | 157-158℃ | |
| MSDS | N/A | Flash Point | 132.7ºC | |
| Name | 5-(4-tert-butylphenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19 g/cm3 |
|---|---|
| Boiling Point | 295.8ºC at 760 mmHg |
| Melting Point | 157-158℃ |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.31700 |
| Flash Point | 132.7ºC |
| Exact Mass | 234.08300 |
| PSA | 77.72000 |
| LogP | 3.32280 |
| InChIKey | ATIYHEZPBLMRNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(-c2n[nH]c(=S)o2)cc1 |
|
~%
5-[4-(tert-buty... CAS#:306936-90-3 |
| Literature: US2009/291967 A1, ; Page/Page column 39 ; |
|
~%
5-[4-(tert-buty... CAS#:306936-90-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 11 p. 3615 - 3621 |
|
~%
5-[4-(tert-buty... CAS#:306936-90-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 8 p. 2286 - 2297 |
| f2146-0017 |