N-(2-Hydroxyethyl)-N,3-diphenylpropenamide structure
|
Common Name | N-(2-Hydroxyethyl)-N,3-diphenylpropenamide | ||
|---|---|---|---|---|
| CAS Number | 30687-28-6 | Molecular Weight | 267.32200 | |
| Density | 1.193g/cm3 | Boiling Point | 429.8ºC at 760mmHg | |
| Molecular Formula | C17H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7ºC | |
| Name | (E)-N-(2-hydroxyethyl)-N,3-diphenylprop-2-enamide |
|---|
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 429.8ºC at 760mmHg |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.32200 |
| Flash Point | 213.7ºC |
| Exact Mass | 267.12600 |
| PSA | 40.54000 |
| LogP | 2.72530 |
| Index of Refraction | 1.655 |
| InChIKey | NEUSQGNTUOWSEA-VAWYXSNFSA-N |
| SMILES | O=C(C=Cc1ccccc1)N(CCO)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |