a-D-Glucopyranoside, methyl3-deoxy-3-(phenylazo)-4,6-O-(phenylmethylene)- (9CI)
Modify Date: 2025-09-18 16:16:20
a-D-Glucopyranoside, methyl3-deoxy-3-(phenylazo)-4,6-O-(phenylmethylene)- (9CI) structure
|
Common Name | a-D-Glucopyranoside, methyl3-deoxy-3-(phenylazo)-4,6-O-(phenylmethylene)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3068-27-7 | Molecular Weight | 370.39900 | |
| Density | 1.36g/cm3 | Boiling Point | 538.1ºC at 760mmHg | |
| Molecular Formula | C20H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.2ºC | |
| Name | mairin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 538.1ºC at 760mmHg |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.39900 |
| Flash Point | 279.2ºC |
| Exact Mass | 370.15300 |
| PSA | 81.87000 |
| LogP | 2.98530 |
| Index of Refraction | 1.63 |
| InChIKey | GYVWCGHHTHHBJO-UHFFFAOYSA-N |
| SMILES | COC1OC2COC(c3ccccc3)OC2C(N=Nc2ccccc2)C1O |
|
~%
a-D-Glucopyrano... CAS#:3068-27-7 |
| Literature: Guthrie,R.D.; Johnson,L.F. Journal of the Chemical Society, 1961 , p. 4166 - 4172 |
![6-methoxy-2-phenyl-hexahydro-[1,3]dioxino[5,4-e][1,4]dioxepine-7,9-diol structure](https://image.chemsrc.com/caspic/388/4983-69-1.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Gratiolone |
| ALS-357 |
| BETULIC ACID |
| Melaleucin |
| Betulinic |
| Platanol |